C25H34O2 — CID 10883074
(1'R,5'S,8R,9S,13S,14S)-3-ethoxy-13-methylspiro[1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthrene-16,6'-bicyclo[3.1.0]hexane]-17-one (PubChem CID 10883074) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (1'R,5'S,8R,9S,13S,14S)-3-ethoxy-13-methylspiro[1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthrene-16,6'-bicyclo[3.1.0]hexane]-17-one.
| Compound Name | (1'R,5'S,8R,9S,13S,14S)-3-ethoxy-13-methylspiro[1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthrene-16,6'-bicyclo[3.1.0]hexane]-17-one |
|---|---|
| PubChem CID | 10883074 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (1'R,5'S,8R,9S,13S,14S)-3-ethoxy-13-methylspiro[1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthrene-16,6'-bicyclo[3.1.0]hexane]-17-one |
| SMILES | CCOC1=CC2=CC[C@@H]3[C@H](CC[C@]4(C)C(=O)C5(C[C@@H]34)[C@@H]3CCC[C@@H]35)C2CC1 |
| InChI | InChI=1S/C25H34O2/c1-3-27-16-8-10-17-15(13-16)7-9-19-18(17)11-12-24(2)22(19)14-25(23(24)26)20-5-4-6-21(20)25/h7,13,17-22H,3-6,8-12,14H2,1-2H3/t17?,18-,19-,20-,21+,22+,24+,25?/m1/s1 |
| InChIKey | AMLQTPAQSXAGSV-ZTNLZDIWSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |