C21H28F2O2 — CID 154097865
(7S,8R,9S,10R,13S,14S)-7-(difluoromethyl)-3-ethoxy-13-methyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 154097865) has the molecular formula C21H28F2O2 and a molecular weight of 350.45 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S)-7-(difluoromethyl)-3-ethoxy-13-methyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (7S,8R,9S,10R,13S,14S)-7-(difluoromethyl)-3-ethoxy-13-methyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 154097865 |
| Molecular Formula | C21H28F2O2 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S)-7-(difluoromethyl)-3-ethoxy-13-methyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CCOC1=CC2=C[C@@H](C(F)F)[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@H]2CC1 |
| InChI | InChI=1S/C21H28F2O2/c1-3-25-13-4-5-14-12(10-13)11-16(20(22)23)19-15(14)8-9-21(2)17(19)6-7-18(21)24/h10-11,14-17,19-20H,3-9H2,1-2H3/t14-,15+,16+,17-,19-,21-/m0/s1 |
| InChIKey | VUPWGBCQVIXXOV-QYNIMHRHSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |