C33H60O5Si4 — CID 91752474
1-[(10R,13S,17R)-10,13-dimethyl-3,11,17-tris(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanone (PubChem CID 91752474) has the molecular formula C33H60O5Si4 and a molecular weight of 649.18 g/mol. Its IUPAC name is 1-[(10R,13S,17R)-10,13-dimethyl-3,11,17-tris(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanone.
| Compound Name | 1-[(10R,13S,17R)-10,13-dimethyl-3,11,17-tris(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanone |
|---|---|
| PubChem CID | 91752474 |
| Molecular Formula | C33H60O5Si4 |
| Molecular Weight | 649.18 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | 1-[(10R,13S,17R)-10,13-dimethyl-3,11,17-tris(trimethylsilyloxy)-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-trimethylsilyloxyethanone |
| SMILES | C[C@]12C=CC(O[Si](C)(C)C)=CC1=CCC1C2C(O[Si](C)(C)C)C[C@@]2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C |
| InChI | InChI=1S/C33H60O5Si4/c1-31-19-17-25(36-40(6,7)8)21-24(31)15-16-26-27-18-20-33(38-42(12,13)14,29(34)23-35-39(3,4)5)32(27,2)22-28(30(26)31)37-41(9,10)11/h15,17,19,21,26-28,30H,16,18,20,22-23H2,1-14H3/t26?,27?,28?,30?,31-,32-,33-/m0/s1 |
| InChIKey | AWFNVAAHFNIRPH-BIWBYKBTSA-N |
| XLogP | 8.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.18 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|