C31H59NO4Si3 — CID 91752019
1-[(3S,13S,15R)-10,13-dimethyl-3,15,17-tris(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine (PubChem CID 91752019) has the molecular formula C31H59NO4Si3 and a molecular weight of 594.07 g/mol. Its IUPAC name is 1-[(3S,13S,15R)-10,13-dimethyl-3,15,17-tris(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine.
| Compound Name | 1-[(3S,13S,15R)-10,13-dimethyl-3,15,17-tris(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 91752019 |
| Molecular Formula | C31H59NO4Si3 |
| Molecular Weight | 594.07 g/mol |
| Exact Mass | 593.38 |
| IUPAC Name | 1-[(3S,13S,15R)-10,13-dimethyl-3,15,17-tris(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-N-methoxyethanimine |
| SMILES | CON=C(C)C1(O[Si](C)(C)C)CC(O[Si](C)(C)C)C2C3CC=C4C[C@@H](O[Si](C)(C)C)CCC4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H59NO4Si3/c1-22(32-33-4)31(36-39(11,12)13)21-27(35-38(8,9)10)28-25-15-14-23-20-24(34-37(5,6)7)16-18-29(23,2)26(25)17-19-30(28,31)3/h14,24-28H,15-21H2,1-13H3/t24-,25?,26?,27?,28?,29?,30-,31?/m0/s1 |
| InChIKey | HGNJIMJEZYWJLX-JOKKDKSBSA-N |
| XLogP | 8.61 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.07 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|