C26H47NO3Si2 — CID 20845355
(E,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-3,17-bis(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-imine (PubChem CID 20845355) has the molecular formula C26H47NO3Si2 and a molecular weight of 477.84 g/mol. Its IUPAC name is (E,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-3,17-bis(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-imine.
| Compound Name | (E,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-3,17-bis(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-imine |
|---|---|
| PubChem CID | 20845355 |
| Molecular Formula | C26H47NO3Si2 |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | (E,8R,9S,10R,13S,14S)-N-methoxy-10,13-dimethyl-3,17-bis(trimethylsilyloxy)-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-imine |
| SMILES | CO/N=C1\C[C@H]2[C@@H]3CC=C4CC(O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]2(C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C26H47NO3Si2/c1-25-14-12-19(29-31(4,5)6)16-18(25)10-11-20-21(25)13-15-26(2)22(20)17-23(27-28-3)24(26)30-32(7,8)9/h10,19-22,24H,11-17H2,1-9H3/b27-23+/t19?,20-,21+,22+,24?,25+,26+/m1/s1 |
| InChIKey | BXLITIIYITYRJV-FSLUUYTPSA-N |
| XLogP | 7.00 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|