C29H53FO3Si3 — CID 91753560
[(9R,17S)-9-fluoro-10,13,17-trimethyl-3,11-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 91753560) has the molecular formula C29H53FO3Si3 and a molecular weight of 553.00 g/mol. Its IUPAC name is [(9R,17S)-9-fluoro-10,13,17-trimethyl-3,11-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(9R,17S)-9-fluoro-10,13,17-trimethyl-3,11-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91753560 |
| Molecular Formula | C29H53FO3Si3 |
| Molecular Weight | 553.00 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | [(9R,17S)-9-fluoro-10,13,17-trimethyl-3,11-bis(trimethylsilyloxy)-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | CC12CCC(O[Si](C)(C)C)=CC1=CCC1C3CC[C@](C)(O[Si](C)(C)C)C3(C)CC(O[Si](C)(C)C)[C@@]12F |
| InChI | InChI=1S/C29H53FO3Si3/c1-26-17-15-22(31-34(4,5)6)19-21(26)13-14-24-23-16-18-28(3,33-36(10,11)12)27(23,2)20-25(29(24,26)30)32-35(7,8)9/h13,19,23-25H,14-18,20H2,1-12H3/t23?,24?,25?,26?,27?,28-,29-/m0/s1 |
| InChIKey | WDLOCDDPAONUQC-OKPYCMANSA-N |
| XLogP | 8.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.00 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|