C27H36FN2O6+ — CID 59835318
CID 59835318 (PubChem CID 59835318) has the molecular formula C27H36FN2O6+ and a molecular weight of 503.59 g/mol.
| Compound Name | CID 59835318 |
|---|---|
| PubChem CID | 59835318 |
| Molecular Formula | C27H36FN2O6+ |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | — |
| SMILES | CC(=O)n1cc2c([nH+]1)C=C1CC[C@H]3[C@@H]4C[C@@H](C)[C@@]5(OCOC56COCO6)[C@@]4(C)C[C@H](O)[C@]3(F)[C@@]1(C)C2 |
| InChI | InChI=1S/C27H35FN2O6/c1-15-7-20-19-6-5-18-8-21-17(11-30(29-21)16(2)31)9-23(18,3)26(19,28)22(32)10-24(20,4)27(15)25(35-14-36-27)12-33-13-34-25/h8,11,15,19-20,22,32H,5-7,9-10,12-14H2,1-4H3/p+1/t15-,19+,20+,22+,23+,24+,25?,26+,27-/m1/s1 |
| InChIKey | QJDFTJVPQSGUPC-BVBVZNBCSA-O |
| XLogP | 2.90 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |