C24H30F2O6 — CID 91001940
CID 91001940 (PubChem CID 91001940) has the molecular formula C24H30F2O6 and a molecular weight of 452.49 g/mol.
| Compound Name | CID 91001940 |
|---|---|
| PubChem CID | 91001940 |
| Molecular Formula | C24H30F2O6 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | — |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CC(F)=C4CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@]12OCOC21COCO1 |
| InChI | InChI=1S/C24H30F2O6/c1-13-6-15-16-8-18(25)17-7-14(27)4-5-20(17,2)23(16,26)19(28)9-21(15,3)24(13)22(31-12-32-24)10-29-11-30-22/h4-5,13,15-16,19,28H,6-12H2,1-3H3/t13-,15-,16-,19-,20-,21-,22?,23-,24+/m0/s1 |
| InChIKey | KKGPBWSLHFLJKS-GDDIWXMRSA-N |
| XLogP | 3.34 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |