C22H33F — CID 22810958
(8S,9R,10S,13R,14S,16S,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22810958) has the molecular formula C22H33F and a molecular weight of 316.50 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,16S,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,16S,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22810958 |
| Molecular Formula | C22H33F |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | (8S,9R,10S,13R,14S,16S,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC[C@@H]1[C@@H](C)C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C22H33F/c1-5-17-15(2)14-19-18-10-9-16-8-6-7-11-21(16,4)22(18,23)13-12-20(17,19)3/h7-8,11,15,17-19H,5-6,9-10,12-14H2,1-4H3/t15-,17+,18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | RKWYVIIRVNFNMM-NVSNUPHBSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|