C22H33Br — CID 154093396
(7R,8S,9S,10R,13R,14S,16R,17S)-7-bromo-17-ethyl-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene (PubChem CID 154093396) has the molecular formula C22H33Br and a molecular weight of 377.41 g/mol. Its IUPAC name is (7R,8S,9S,10R,13R,14S,16R,17S)-7-bromo-17-ethyl-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene.
| Compound Name | (7R,8S,9S,10R,13R,14S,16R,17S)-7-bromo-17-ethyl-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154093396 |
| Molecular Formula | C22H33Br |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (7R,8S,9S,10R,13R,14S,16R,17S)-7-bromo-17-ethyl-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1[C@H](C)C[C@H]2[C@@H]3[C@H](Br)CC4=CCC=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H33Br/c1-5-16-14(2)12-18-20-17(9-11-22(16,18)4)21(3)10-7-6-8-15(21)13-19(20)23/h7-8,10,14,16-20H,5-6,9,11-13H2,1-4H3/t14-,16+,17+,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | HYVAIVARMONOEP-YPQOCWOCSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|