C23H32O3S — CID 142778436
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-propanoyloxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 142778436) has the molecular formula C23H32O3S and a molecular weight of 388.57 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-17-propanoyloxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-propanoyloxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 142778436 |
| Molecular Formula | C23H32O3S |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-propanoyloxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CCC(=O)OC1(C(=O)S)CC[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H32O3S/c1-4-19(24)26-23(20(25)27)14-11-18-16-9-8-15-7-5-6-12-21(15,2)17(16)10-13-22(18,23)3/h6-7,12,16-18H,4-5,8-11,13-14H2,1-3H3,(H,25,27)/t16-,17+,18+,21+,22+,23?/m1/s1 |
| InChIKey | TXSIDKABQLXCED-GLQGKLMTSA-N |
| XLogP | 5.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|