C28H38O4 — CID 70616119
[(8R,9S,10R,13S,14S,17R)-17-acetyl-16-butylidene-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 70616119) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-acetyl-16-butylidene-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-16-butylidene-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 70616119 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-16-butylidene-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCCC=C1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]2(C)[C@@]1(OC(=O)CC)C(C)=O |
| InChI | InChI=1S/C28H38O4/c1-6-8-9-20-17-24-22-11-10-19-16-21(30)12-14-26(19,4)23(22)13-15-27(24,5)28(20,18(3)29)32-25(31)7-2/h9,12,14,16,22-24H,6-8,10-11,13,15,17H2,1-5H3/t22-,23+,24+,26+,27+,28-/m1/s1 |
| InChIKey | MJXSSLGNTLTPAH-GOSCKZQVSA-N |
| XLogP | 5.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|