C24H32O5S — CID 22815614
[(8R,9S,10R,13S,14S,16S,17R)-17-hydroperoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 22815614) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,16S,17R)-17-hydroperoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9S,10R,13S,14S,16S,17R)-17-hydroperoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 22815614 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [(8R,9S,10R,13S,14S,16S,17R)-17-hydroperoxycarbothioyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=S)OO)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H32O5S/c1-5-20(26)28-24(21(30)29-27)14(2)12-19-17-7-6-15-13-16(25)8-10-22(15,3)18(17)9-11-23(19,24)4/h8,10,13-14,17-19,27H,5-7,9,11-12H2,1-4H3/t14-,17+,18-,19-,22-,23-,24-/m0/s1 |
| InChIKey | JZPXKUUFAKMSLS-HOFPXMEUSA-N |
| XLogP | 5.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|