C29H35NO4 — CID 142928137
[(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-phenylcarbamate (PubChem CID 142928137) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-phenylcarbamate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 142928137 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] N-phenylcarbamate |
| SMILES | CC(=O)[C@@]1(OC(=O)Nc2ccccc2)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H35NO4/c1-18-16-25-23-11-10-20-17-22(32)12-14-27(20,3)24(23)13-15-28(25,4)29(18,19(2)31)34-26(33)30-21-8-6-5-7-9-21/h5-9,12,14,17-18,23-25H,10-11,13,15-16H2,1-4H3,(H,30,33)/t18?,23-,24+,25+,27+,28+,29+/m1/s1 |
| InChIKey | FBHSUWDSFUKICJ-OMKCSGKUSA-N |
| XLogP | 6.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |