C19H24F2O2 — CID 162047823
(8R,9S,10R,13S,14S)-17,17-difluoro-16-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 162047823) has the molecular formula C19H24F2O2 and a molecular weight of 322.39 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17,17-difluoro-16-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-17,17-difluoro-16-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162047823 |
| Molecular Formula | C19H24F2O2 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17,17-difluoro-16-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC(O)C2(F)F |
| InChI | InChI=1S/C19H24F2O2/c1-17-7-5-12(22)9-11(17)3-4-13-14(17)6-8-18(2)15(13)10-16(23)19(18,20)21/h5,7,9,13-16,23H,3-4,6,8,10H2,1-2H3/t13-,14+,15+,16?,17+,18+/m1/s1 |
| InChIKey | YYDFJDKMFRJSPT-AEUKNGSLSA-N |
| XLogP | 3.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |