C30H41NO4 — CID 68899014
cyanomethyl (8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 68899014) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is cyanomethyl (8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | cyanomethyl (8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 68899014 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | cyanomethyl (8R,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2,2,3,3-tetramethylcyclopropanecarbonyl)oxy-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC1(C)C(C(=O)O[C@]2(C(=O)OCC#N)CC[C@H]3[C@@H]4CCC5=CCC=C[C@]5(C)[C@H]4CC[C@@]32C)C1(C)C |
| InChI | InChI=1S/C30H41NO4/c1-26(2)23(27(26,3)4)24(32)35-30(25(33)34-18-17-31)16-13-22-20-11-10-19-9-7-8-14-28(19,5)21(20)12-15-29(22,30)6/h8-9,14,20-23H,7,10-13,15-16,18H2,1-6H3/t20-,21+,22+,28+,29+,30+/m1/s1 |
| InChIKey | IAMPUZXOQMGPRL-LYGYMCCUSA-N |
| XLogP | 6.15 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|