C27H45NO3Si — CID 154148511
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-trimethylsilyloxyethyl)-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] N-ethylcarbamate (PubChem CID 154148511) has the molecular formula C27H45NO3Si and a molecular weight of 459.75 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-trimethylsilyloxyethyl)-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] N-ethylcarbamate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-trimethylsilyloxyethyl)-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 154148511 |
| Molecular Formula | C27H45NO3Si |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-trimethylsilyloxyethyl)-3,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)O[C@]1(CCO[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H45NO3Si/c1-7-28-24(29)31-27(18-19-30-32(4,5)6)17-14-23-21-12-11-20-10-8-9-15-25(20,2)22(21)13-16-26(23,27)3/h9-10,15,21-23H,7-8,11-14,16-19H2,1-6H3,(H,28,29)/t21-,22+,23+,25+,26+,27+/m1/s1 |
| InChIKey | AOAZTDMRAJEWAO-LJHIYBGHSA-N |
| XLogP | 6.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|