C22H32O2 — CID 22810584
[(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl] propanoate (PubChem CID 22810584) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl] propanoate.
| Compound Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl] propanoate |
|---|---|
| PubChem CID | 22810584 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl] propanoate |
| SMILES | CCC(=O)OC1C=C[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CCC[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H32O2/c1-4-20(23)24-16-9-13-22(3)15(14-16)7-8-17-18-6-5-11-21(18,2)12-10-19(17)22/h9,13-14,16-19H,4-8,10-12H2,1-3H3/t16?,17-,18-,19-,21-,22-/m0/s1 |
| InChIKey | FROZNBNAFDLQBQ-BRNZWBCRSA-N |
| XLogP | 5.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|