C23H32O9S2 — CID 90785326
[3-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl]oxy]-3-oxopropoxy]sulfonyl-oxomethanesulfonic acid (PubChem CID 90785326) has the molecular formula C23H32O9S2 and a molecular weight of 516.63 g/mol. Its IUPAC name is [3-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl]oxy]-3-oxopropoxy]sulfonyl-oxomethanesulfonic acid.
| Compound Name | [3-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl]oxy]-3-oxopropoxy]sulfonyl-oxomethanesulfonic acid |
|---|---|
| PubChem CID | 90785326 |
| Molecular Formula | C23H32O9S2 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [3-[[(8S,9S,10R,13S,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-yl]oxy]-3-oxopropoxy]sulfonyl-oxomethanesulfonic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(OC(=O)CCOS(=O)(=O)C(=O)S(=O)(=O)O)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C23H32O9S2/c1-22-10-3-4-18(22)17-6-5-15-14-16(7-12-23(15,2)19(17)8-11-22)32-20(24)9-13-31-34(29,30)21(25)33(26,27)28/h7,12,14,16-19H,3-6,8-11,13H2,1-2H3,(H,26,27,28)/t16?,17-,18-,19-,22-,23-/m0/s1 |
| InChIKey | HREXPIVNPYTXSW-PEOPJJLYSA-N |
| XLogP | 3.77 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|