C21H30O3 — CID 154731873
[(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 154731873) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 154731873 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(8S,9S,10R,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@]2(C)C(=CC1=O)CC[C@H]1[C@@H]3CCC[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O3/c1-13(22)24-19-12-21(3)14(11-18(19)23)6-7-15-16-5-4-9-20(16,2)10-8-17(15)21/h11,15-17,19H,4-10,12H2,1-3H3/t15-,16-,17-,19?,20-,21-/m0/s1 |
| InChIKey | TYVOTOKKBSVAQA-SBNILOIZSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |