C20H27ClO3 — CID 123691454
(8S,9R,10R,13S,14S)-1-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylic acid (PubChem CID 123691454) has the molecular formula C20H27ClO3 and a molecular weight of 350.89 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-1-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylic acid.
| Compound Name | (8S,9R,10R,13S,14S)-1-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 123691454 |
| Molecular Formula | C20H27ClO3 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (8S,9R,10R,13S,14S)-1-chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-2-carboxylic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(C(=O)O)C(Cl)[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C20H27ClO3/c1-19-8-3-4-13(19)12-6-5-11-10-15(22)16(18(23)24)17(21)20(11,2)14(12)7-9-19/h10,12-14,16-17H,3-9H2,1-2H3,(H,23,24)/t12-,13-,14+,16?,17?,19-,20-/m0/s1 |
| InChIKey | QXOPMOWAZOKENJ-KHLZRDKXSA-N |
| XLogP | 4.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|