C25H30OS — CID 70442233
(8S,9S,10R,13S,14S)-10,13-dimethyl-1-phenylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70442233) has the molecular formula C25H30OS and a molecular weight of 378.58 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-10,13-dimethyl-1-phenylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-1-phenylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70442233 |
| Molecular Formula | C25H30OS |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (8S,9S,10R,13S,14S)-10,13-dimethyl-1-phenylsulfanyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C=C(Sc4ccccc4)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C25H30OS/c1-24-13-6-9-21(24)20-11-10-17-15-18(26)16-23(25(17,2)22(20)12-14-24)27-19-7-4-3-5-8-19/h3-5,7-8,15-16,20-22H,6,9-14H2,1-2H3/t20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | SRDWZBXYGJOJMZ-YNFQPMOCSA-N |
| XLogP | 6.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |