C20H27FOS — CID 54239813
(8S,9S,10S,13S,14S)-2-(fluoromethylsulfanyl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 54239813) has the molecular formula C20H27FOS and a molecular weight of 334.50 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-2-(fluoromethylsulfanyl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10S,13S,14S)-2-(fluoromethylsulfanyl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54239813 |
| Molecular Formula | C20H27FOS |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (8S,9S,10S,13S,14S)-2-(fluoromethylsulfanyl)-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(SCF)=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H27FOS/c1-19-8-3-4-15(19)14-6-5-13-10-17(22)18(23-12-21)11-20(13,2)16(14)7-9-19/h10-11,14-16H,3-9,12H2,1-2H3/t14-,15-,16-,19-,20-/m0/s1 |
| InChIKey | QPFACDWYQMAWGB-UKSSEWCLSA-N |
| XLogP | 5.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |