C20H28O3 — CID 57023741
(8S,9R,10S,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carboxylic acid (PubChem CID 57023741) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carboxylic acid.
| Compound Name | (8S,9R,10S,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 57023741 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (8S,9R,10S,13S,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1-carboxylic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)CC(C(=O)O)[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C20H28O3/c1-19-8-3-4-15(19)14-6-5-12-10-13(21)11-17(18(22)23)20(12,2)16(14)7-9-19/h10,14-17H,3-9,11H2,1-2H3,(H,22,23)/t14-,15-,16+,17?,19-,20-/m0/s1 |
| InChIKey | BDUBTSZLZOSCRZ-KIRNONNFSA-N |
| XLogP | 4.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |