C19H26F2O2 — CID 57220531
(8S,9R,10R,13R,14S)-16,16-difluoro-2-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57220531) has the molecular formula C19H26F2O2 and a molecular weight of 324.41 g/mol. Its IUPAC name is (8S,9R,10R,13R,14S)-16,16-difluoro-2-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,13R,14S)-16,16-difluoro-2-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57220531 |
| Molecular Formula | C19H26F2O2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (8S,9R,10R,13R,14S)-16,16-difluoro-2-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CCC4=CC(=O)C(O)C[C@@]43C)[C@@H]1CC(F)(F)C2 |
| InChI | InChI=1S/C19H26F2O2/c1-17-6-5-13-12(14(17)8-19(20,21)10-17)4-3-11-7-15(22)16(23)9-18(11,13)2/h7,12-14,16,23H,3-6,8-10H2,1-2H3/t12-,13-,14+,16?,17-,18+/m1/s1 |
| InChIKey | HQGYJGNUEYSGPO-RSNFVWLGSA-N |
| XLogP | 4.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |