C20H30O3 — CID 10471150
(2S,8R,9S,10R,13S,14S,17S)-2-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10471150) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2S,8R,9S,10R,13S,14S,17S)-2-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (2S,8R,9S,10R,13S,14S,17S)-2-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10471150 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S,8R,9S,10R,13S,14S,17S)-2-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CO[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H30O3/c1-19-9-8-15-13(14(19)6-7-18(19)23-3)5-4-12-10-16(21)17(22)11-20(12,15)2/h10,13-15,17-18,22H,4-9,11H2,1-3H3/t13-,14-,15-,17-,18-,19-,20-/m0/s1 |
| InChIKey | CWPUYGKAIIYGGE-VJLCOJPHSA-N |
| XLogP | 3.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |