C21H31ClO3 — CID 69348820
(8S,9S,10R,11S,13S,14S,17R)-2-(chloromethyl)-11-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 69348820) has the molecular formula C21H31ClO3 and a molecular weight of 366.93 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17R)-2-(chloromethyl)-11-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S,17R)-2-(chloromethyl)-11-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 69348820 |
| Molecular Formula | C21H31ClO3 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-2-(chloromethyl)-11-hydroxy-17-methoxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CO[C@@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(CCl)C[C@]4(C)[C@H]3[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C21H31ClO3/c1-20-9-12(11-22)16(23)8-13(20)4-5-14-15-6-7-18(25-3)21(15,2)10-17(24)19(14)20/h8,12,14-15,17-19,24H,4-7,9-11H2,1-3H3/t12?,14-,15-,17-,18+,19+,20-,21-/m0/s1 |
| InChIKey | YVVDTRJZKKZGHE-ZFANDJBDSA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|