C24H37ClO3 — CID 69348714
(8S,9S,10R,11S,13S,14S,17R)-17-butoxy-2-(chloromethyl)-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 69348714) has the molecular formula C24H37ClO3 and a molecular weight of 409.01 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17R)-17-butoxy-2-(chloromethyl)-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S,17R)-17-butoxy-2-(chloromethyl)-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 69348714 |
| Molecular Formula | C24H37ClO3 |
| Molecular Weight | 409.01 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-17-butoxy-2-(chloromethyl)-11-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCCCO[C@@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(CCl)C[C@]4(C)[C@H]3[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C24H37ClO3/c1-4-5-10-28-21-9-8-18-17-7-6-16-11-19(26)15(14-25)12-23(16,2)22(17)20(27)13-24(18,21)3/h11,15,17-18,20-22,27H,4-10,12-14H2,1-3H3/t15?,17-,18-,20-,21+,22+,23-,24-/m0/s1 |
| InChIKey | NCJNLRSYMNELPO-NMRXXYDTSA-N |
| XLogP | 5.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|