C22H33NO2 — CID 129187261
(10R,11S,13S,17S)-17-[(dimethylamino)methyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129187261) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (10R,11S,13S,17S)-17-[(dimethylamino)methyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,11S,13S,17S)-17-[(dimethylamino)methyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129187261 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (10R,11S,13S,17S)-17-[(dimethylamino)methyl]-11-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)C[C@H]1CCC2C3CCC4=CC(=O)C=C[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C22H33NO2/c1-21-10-9-16(24)11-14(21)5-7-17-18-8-6-15(13-23(3)4)22(18,2)12-19(25)20(17)21/h9-11,15,17-20,25H,5-8,12-13H2,1-4H3/t15-,17?,18?,19?,20?,21+,22-/m1/s1 |
| InChIKey | NKGVHJQWWUIWLO-AUUWAQPNSA-N |
| XLogP | 3.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |