C21H28O3 — CID 143213222
acetaldehyde;9-hydroxy-11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one (PubChem CID 143213222) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is acetaldehyde;9-hydroxy-11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one.
| Compound Name | acetaldehyde;9-hydroxy-11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one |
|---|---|
| PubChem CID | 143213222 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | acetaldehyde;9-hydroxy-11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC23CC2CCC13.CC=O |
| InChI | InChI=1S/C19H24O2.C2H4O/c1-18-7-6-13(20)8-11(18)2-4-14-15-5-3-12-9-19(12,15)10-16(21)17(14)18;1-2-3/h6-8,12,14-17,21H,2-5,9-10H2,1H3;2H,1H3 |
| InChIKey | DOUKCGUKXYBDFI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|