C21H32O2 — CID 142985410
(17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol (PubChem CID 142985410) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | (17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 142985410 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol |
| SMILES | CO[C@@H]1CCC2C3CCC4=C(C)CC=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C21H32O2/c1-13-6-5-11-20(2)15(13)8-7-14-16-9-10-18(23-4)21(16,3)12-17(22)19(14)20/h5,11,14,16-19,22H,6-10,12H2,1-4H3/t14?,16?,17?,18-,19?,20?,21?/m1/s1 |
| InChIKey | NHBTWXFENHQLTJ-GDDDMTNASA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|