C26H44O4 — CID 142985409
ethane;1-hydroxypropan-2-one;(17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol (PubChem CID 142985409) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is ethane;1-hydroxypropan-2-one;(17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | ethane;1-hydroxypropan-2-one;(17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 142985409 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | ethane;1-hydroxypropan-2-one;(17R)-17-methoxy-4,10,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-11-ol |
| SMILES | CC.CC(=O)CO.CO[C@@H]1CCC2C3CCC4=C(C)CC=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C21H32O2.C3H6O2.C2H6/c1-13-6-5-11-20(2)15(13)8-7-14-16-9-10-18(23-4)21(16,3)12-17(22)19(14)20;1-3(5)2-4;1-2/h5,11,14,16-19,22H,6-10,12H2,1-4H3;4H,2H2,1H3;1-2H3/t14?,16?,17?,18-,19?,20?,21?;;/m1../s1 |
| InChIKey | RMZLDMZRGMJJQF-UQINYFGKSA-N |
| XLogP | 5.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|