C22H30O5 — CID 91606889
ethyl (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate (PubChem CID 91606889) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is ethyl (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate.
| Compound Name | ethyl (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 91606889 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | ethyl (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@]2(C)C(=CC1=O)CC[C@@H]1[C@H]2C(O)C[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C22H30O5/c1-4-27-20(26)14-10-21(2)12(9-16(14)23)5-6-13-15-7-8-18(25)22(15,3)11-17(24)19(13)21/h9-10,13,15,17-19,24-25H,4-8,11H2,1-3H3/t13-,15-,17?,18?,19-,21-,22-/m0/s1 |
| InChIKey | NWDCGPMLHBBNRI-JEAQGPFJSA-N |
| XLogP | 2.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|