C22H29FO3S — CID 91351887
S-(fluoromethyl) (8S,9S,10R,13S,14S)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carbothioate (PubChem CID 91351887) has the molecular formula C22H29FO3S and a molecular weight of 392.54 g/mol. Its IUPAC name is S-(fluoromethyl) (8S,9S,10R,13S,14S)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carbothioate.
| Compound Name | S-(fluoromethyl) (8S,9S,10R,13S,14S)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carbothioate |
|---|---|
| PubChem CID | 91351887 |
| Molecular Formula | C22H29FO3S |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | S-(fluoromethyl) (8S,9S,10R,13S,14S)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-2-carbothioate |
| SMILES | CC1C[C@H]2[C@@H]3CCC4=CC(=O)C(C(=O)SCF)=C[C@]4(C)[C@H]3C(O)C[C@]2(C)C1 |
| InChI | InChI=1S/C22H29FO3S/c1-12-6-16-14-5-4-13-7-17(24)15(20(26)27-11-23)9-22(13,3)19(14)18(25)10-21(16,2)8-12/h7,9,12,14,16,18-19,25H,4-6,8,10-11H2,1-3H3/t12?,14-,16-,18?,19+,21-,22-/m0/s1 |
| InChIKey | RZNHOAGXYOBSSY-IMXJTQIOSA-N |
| XLogP | 4.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|