C22H28O4 — CID 129233103
(8S,10R,11S,13S)-11-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129233103) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (8S,10R,11S,13S)-11-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10R,11S,13S)-11-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129233103 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (8S,10R,11S,13S)-11-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C[C@@]2(C)C(=CC1=O)CC[C@@H]1C2C(O)C[C@]2(C)C(C(=O)CO)=CCC12 |
| InChI | InChI=1S/C22H28O4/c1-12-9-21(2)13(8-17(12)24)4-5-14-15-6-7-16(19(26)11-23)22(15,3)10-18(25)20(14)21/h7-9,14-15,18,20,23,25H,4-6,10-11H2,1-3H3/t14-,15?,18?,20?,21-,22-/m0/s1 |
| InChIKey | MXRCKLBBHBCZBF-IJEBPGPASA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |