C25H27F3O6 — CID 67906065
[(8S,9S,10R,11S,13S,14S)-17-(2-acetyloxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-11-yl] 2,2,2-trifluoroacetate (PubChem CID 67906065) has the molecular formula C25H27F3O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S)-17-(2-acetyloxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-11-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(8S,9S,10R,11S,13S,14S)-17-(2-acetyloxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-11-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67906065 |
| Molecular Formula | C25H27F3O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S)-17-(2-acetyloxyacetyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-11-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)OCC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](OC(=O)C(F)(F)F)C[C@]12C |
| InChI | InChI=1S/C25H27F3O6/c1-13(29)33-12-19(31)18-7-6-17-16-5-4-14-10-15(30)8-9-23(14,2)21(16)20(11-24(17,18)3)34-22(32)25(26,27)28/h7-10,16-17,20-21H,4-6,11-12H2,1-3H3/t16-,17-,20-,21+,23-,24-/m0/s1 |
| InChIKey | CEWTYZYEGQHRJV-QMDMHIFZSA-N |
| XLogP | 4.05 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |