C23H29IO5 — CID 154220185
[2-[(8S,9S,10R,11R,13S,14S)-11-hydroxy-2-iodo-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 154220185) has the molecular formula C23H29IO5 and a molecular weight of 512.38 g/mol. Its IUPAC name is [2-[(8S,9S,10R,11R,13S,14S)-11-hydroxy-2-iodo-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9S,10R,11R,13S,14S)-11-hydroxy-2-iodo-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 154220185 |
| Molecular Formula | C23H29IO5 |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | [2-[(8S,9S,10R,11R,13S,14S)-11-hydroxy-2-iodo-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C(I)C[C@]4(C)[C@H]3[C@H](O)C[C@]12C |
| InChI | InChI=1S/C23H29IO5/c1-12(25)29-11-20(28)16-7-6-15-14-5-4-13-8-18(26)17(24)9-22(13,2)21(14)19(27)10-23(15,16)3/h7-8,14-15,17,19,21,27H,4-6,9-11H2,1-3H3/t14-,15-,17?,19+,21+,22-,23-/m0/s1 |
| InChIKey | GIGOVNFQZSWOFV-PJSMQYLBSA-N |
| XLogP | 3.57 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|