C24H34O4 — CID 125036346
[(2E)-2-[(2R,8S,9R,10R,11R,13R,14R)-11-hydroxy-2,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl] acetate (PubChem CID 125036346) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [(2E)-2-[(2R,8S,9R,10R,11R,13R,14R)-11-hydroxy-2,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl] acetate.
| Compound Name | [(2E)-2-[(2R,8S,9R,10R,11R,13R,14R)-11-hydroxy-2,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 125036346 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(2E)-2-[(2R,8S,9R,10R,11R,13R,14R)-11-hydroxy-2,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ylidene]ethyl] acetate |
| SMILES | CC(=O)OC/C=C1\CC[C@@H]2[C@@H]3CCC4=CC(=O)[C@H](C)C[C@]4(C)[C@@H]3[C@H](O)C[C@@]12C |
| InChI | InChI=1S/C24H34O4/c1-14-12-24(4)17(11-20(14)26)5-7-18-19-8-6-16(9-10-28-15(2)25)23(19,3)13-21(27)22(18)24/h9,11,14,18-19,21-22,27H,5-8,10,12-13H2,1-4H3/b16-9+/t14-,18+,19-,21-,22+,23+,24+/m1/s1 |
| InChIKey | VUBSNEZHSXMUCR-ZRMLVRLBSA-N |
| XLogP | 4.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|