C23H28O5 — CID 88652453
[2-[(1S,2R,11S,12S,16S)-2,16-dimethyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,14-dien-15-yl]-2-oxoethyl] acetate (PubChem CID 88652453) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is [2-[(1S,2R,11S,12S,16S)-2,16-dimethyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,14-dien-15-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1S,2R,11S,12S,16S)-2,16-dimethyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,14-dien-15-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 88652453 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [2-[(1S,2R,11S,12S,16S)-2,16-dimethyl-6-oxo-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,14-dien-15-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1=CC[C@H]2[C@@H]3CCC4=CC(=O)C5OC5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H28O5/c1-12(24)27-11-19(26)17-7-6-15-14-5-4-13-10-18(25)20-21(28-20)23(13,3)16(14)8-9-22(15,17)2/h7,10,14-16,20-21H,4-6,8-9,11H2,1-3H3/t14-,15-,16-,20?,21?,22-,23-/m0/s1 |
| InChIKey | ZSZCDIOGPUKLKL-WZOPVYJJSA-N |
| XLogP | 3.17 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|