C25H29FO6 — CID 162860698
methyl (8R,9S,10S,11R,13S,14S)-17-(2-acetyloxyacetyl)-9-fluoro-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-11-carboxylate (PubChem CID 162860698) has the molecular formula C25H29FO6 and a molecular weight of 444.50 g/mol. Its IUPAC name is methyl (8R,9S,10S,11R,13S,14S)-17-(2-acetyloxyacetyl)-9-fluoro-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-11-carboxylate.
| Compound Name | methyl (8R,9S,10S,11R,13S,14S)-17-(2-acetyloxyacetyl)-9-fluoro-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-11-carboxylate |
|---|---|
| PubChem CID | 162860698 |
| Molecular Formula | C25H29FO6 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | methyl (8R,9S,10S,11R,13S,14S)-17-(2-acetyloxyacetyl)-9-fluoro-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-11-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(C)C(C(=O)COC(C)=O)=CC[C@H]2[C@H]2CCC3=CC(=O)C=C[C@]3(C)[C@@]12F |
| InChI | InChI=1S/C25H29FO6/c1-14(27)32-13-21(29)19-8-7-17-18-6-5-15-11-16(28)9-10-24(15,3)25(18,26)20(22(30)31-4)12-23(17,19)2/h8-11,17-18,20H,5-7,12-13H2,1-4H3/t17-,18+,20+,23-,24-,25-/m0/s1 |
| InChIKey | QJKIDXTXZKTSLZ-SKVAOSJESA-N |
| XLogP | 3.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |