C24H29FO5 — CID 3824685
[2-(9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate (PubChem CID 3824685) has the molecular formula C24H29FO5 and a molecular weight of 416.49 g/mol. Its IUPAC name is [2-(9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate.
| Compound Name | [2-(9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 3824685 |
| Molecular Formula | C24H29FO5 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [2-(9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)C1=CCC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| InChI | InChI=1S/C24H29FO5/c1-4-21(29)30-13-19(27)18-8-7-16-17-6-5-14-11-15(26)9-10-23(14,3)24(17,25)20(28)12-22(16,18)2/h8-11,16-17,20,28H,4-7,12-13H2,1-3H3 |
| InChIKey | VGZRXZORRFZAKE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |