C24H31FO4 — CID 170453078
ethyl (2Z)-2-(9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ylidene)acetate (PubChem CID 170453078) has the molecular formula C24H31FO4 and a molecular weight of 402.51 g/mol. Its IUPAC name is ethyl (2Z)-2-(9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ylidene)acetate |
|---|---|
| PubChem CID | 170453078 |
| Molecular Formula | C24H31FO4 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | ethyl (2Z)-2-(9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| InChI | InChI=1S/C24H31FO4/c1-5-29-21(28)12-18-14(2)10-19-17-7-6-15-11-16(26)8-9-23(15,4)24(17,25)20(27)13-22(18,19)3/h8-9,11-12,14,17,19-20,27H,5-7,10,13H2,1-4H3/b18-12- |
| InChIKey | ZZQITUIPUODKAL-PDGQHHTCSA-N |
| XLogP | 4.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|