C21H27FO5 — CID 4204365
10b-fluoro-2,3,11-trihydroxy-2,10a,12a-trimethyl-3,4,4a,4b,5,6,11,12-octahydrochrysene-1,8-dione (PubChem CID 4204365) has the molecular formula C21H27FO5 and a molecular weight of 378.44 g/mol. Its IUPAC name is 10b-fluoro-2,3,11-trihydroxy-2,10a,12a-trimethyl-3,4,4a,4b,5,6,11,12-octahydrochrysene-1,8-dione.
| Compound Name | 10b-fluoro-2,3,11-trihydroxy-2,10a,12a-trimethyl-3,4,4a,4b,5,6,11,12-octahydrochrysene-1,8-dione |
|---|---|
| PubChem CID | 4204365 |
| Molecular Formula | C21H27FO5 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 10b-fluoro-2,3,11-trihydroxy-2,10a,12a-trimethyl-3,4,4a,4b,5,6,11,12-octahydrochrysene-1,8-dione |
| SMILES | CC1(O)C(=O)C2(C)CC(O)C3(F)C(CCC4=CC(=O)C=CC43C)C2CC1O |
| InChI | InChI=1S/C21H27FO5/c1-18-10-16(25)21(22)13(14(18)9-15(24)20(3,27)17(18)26)5-4-11-8-12(23)6-7-19(11,21)2/h6-8,13-16,24-25,27H,4-5,9-10H2,1-3H3 |
| InChIKey | SPKUCNSUBYLCEE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |