C22H29FO5S — CID 70565563
(8S,10S,11S,13S,14S)-17-ethylsulfonyl-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70565563) has the molecular formula C22H29FO5S and a molecular weight of 424.53 g/mol. Its IUPAC name is (8S,10S,11S,13S,14S)-17-ethylsulfonyl-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,11S,13S,14S)-17-ethylsulfonyl-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70565563 |
| Molecular Formula | C22H29FO5S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (8S,10S,11S,13S,14S)-17-ethylsulfonyl-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCS(=O)(=O)C1=C(OC)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3(F)[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C22H29FO5S/c1-5-29(26,27)19-17(28-4)11-16-15-7-6-13-10-14(24)8-9-21(13,3)22(15,23)18(25)12-20(16,19)2/h8-10,15-16,18,25H,5-7,11-12H2,1-4H3/t15-,16-,18-,20-,21-,22?/m0/s1 |
| InChIKey | OXKBGUSHBXSPDZ-AGPHWHDGSA-N |
| XLogP | 3.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |