C20H25FO4S — CID 70544973
(8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfonyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70544973) has the molecular formula C20H25FO4S and a molecular weight of 380.48 g/mol. Its IUPAC name is (8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfonyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfonyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70544973 |
| Molecular Formula | C20H25FO4S |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfonyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CC=C(S(C)(=O)=O)[C@@]3(C)C[C@H](O)C12F |
| InChI | InChI=1S/C20H25FO4S/c1-18-11-16(23)20(21)15(14(18)6-7-17(18)26(3,24)25)5-4-12-10-13(22)8-9-19(12,20)2/h7-10,14-16,23H,4-6,11H2,1-3H3/t14-,15-,16-,18-,19-,20?/m0/s1 |
| InChIKey | WRIHSBXAJXPICG-PGYXPUGXSA-N |
| XLogP | 2.90 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |