C24H32ClFO3Si — CID 86736013
(8S,9R,10S,11S,13S,14S)-17-(2-chloro-1-trimethylsilyloxyethenyl)-9-fluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 86736013) has the molecular formula C24H32ClFO3Si and a molecular weight of 451.05 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S)-17-(2-chloro-1-trimethylsilyloxyethenyl)-9-fluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11S,13S,14S)-17-(2-chloro-1-trimethylsilyloxyethenyl)-9-fluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 86736013 |
| Molecular Formula | C24H32ClFO3Si |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S)-17-(2-chloro-1-trimethylsilyloxyethenyl)-9-fluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CC=C(C(=CCl)O[Si](C)(C)C)[C@@]3(C)C[C@H](O)[C@@]12F |
| InChI | InChI=1S/C24H32ClFO3Si/c1-22-13-21(28)24(26)18(7-6-15-12-16(27)10-11-23(15,24)2)17(22)8-9-19(22)20(14-25)29-30(3,4)5/h9-12,14,17-18,21,28H,6-8,13H2,1-5H3/t17-,18-,21-,22-,23-,24-/m0/s1 |
| InChIKey | OEQAMVGJYQLTEE-ASHRYJKQSA-N |
| XLogP | 5.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|