C24H35FO3S2 — CID 88684437
(8S,9R,10S,11R,13S,14S,16R)-17,17-bis(ethylsulfanyl)-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88684437) has the molecular formula C24H35FO3S2 and a molecular weight of 454.67 g/mol. Its IUPAC name is (8S,9R,10S,11R,13S,14S,16R)-17,17-bis(ethylsulfanyl)-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11R,13S,14S,16R)-17,17-bis(ethylsulfanyl)-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88684437 |
| Molecular Formula | C24H35FO3S2 |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (8S,9R,10S,11R,13S,14S,16R)-17,17-bis(ethylsulfanyl)-9-fluoro-11-hydroxy-16-methoxy-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCSC1(SCC)[C@H](OC)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H35FO3S2/c1-6-29-24(30-7-2)20(28-5)13-18-17-9-8-15-12-16(26)10-11-21(15,3)23(17,25)19(27)14-22(18,24)4/h10-12,17-20,27H,6-9,13-14H2,1-5H3/t17-,18-,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | PUNNKRDCNCXSFG-JSXDIISVSA-N |
| XLogP | 5.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|