C23H31FO3S2 — CID 88666677
S-[(8S,9R,10S,11S,13S,14S,17R)-17-ethylsulfanyl-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethanethioate (PubChem CID 88666677) has the molecular formula C23H31FO3S2 and a molecular weight of 438.63 g/mol. Its IUPAC name is S-[(8S,9R,10S,11S,13S,14S,17R)-17-ethylsulfanyl-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethanethioate.
| Compound Name | S-[(8S,9R,10S,11S,13S,14S,17R)-17-ethylsulfanyl-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethanethioate |
|---|---|
| PubChem CID | 88666677 |
| Molecular Formula | C23H31FO3S2 |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | S-[(8S,9R,10S,11S,13S,14S,17R)-17-ethylsulfanyl-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] ethanethioate |
| SMILES | CCS[C@@]1(SC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C23H31FO3S2/c1-5-28-22(29-14(2)25)11-9-17-18-7-6-15-12-16(26)8-10-20(15,3)23(18,24)19(27)13-21(17,22)4/h8,10,12,17-19,27H,5-7,9,11,13H2,1-4H3/t17-,18-,19-,20-,21-,22+,23-/m0/s1 |
| InChIKey | IPYSRCQWDNAIRG-RSRKLVJMSA-N |
| XLogP | 5.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|