C31H33FO2S2 — CID 88684403
(8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17,17-bis(phenylsulfanyl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88684403) has the molecular formula C31H33FO2S2 and a molecular weight of 520.74 g/mol. Its IUPAC name is (8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17,17-bis(phenylsulfanyl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17,17-bis(phenylsulfanyl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88684403 |
| Molecular Formula | C31H33FO2S2 |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | (8S,10S,11S,13S,14S)-9-fluoro-11-hydroxy-10,13-dimethyl-17,17-bis(phenylsulfanyl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CCC(Sc4ccccc4)(Sc4ccccc4)[C@@]3(C)C[C@H](O)C12F |
| InChI | InChI=1S/C31H33FO2S2/c1-28-17-15-22(33)19-21(28)13-14-26-25-16-18-30(35-23-9-5-3-6-10-23,36-24-11-7-4-8-12-24)29(25,2)20-27(34)31(26,28)32/h3-12,15,17,19,25-27,34H,13-14,16,18,20H2,1-2H3/t25-,26-,27-,28-,29-,31?/m0/s1 |
| InChIKey | XRRWJZSDRLBJAJ-YDFWHOQFSA-N |
| XLogP | 7.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|