C34H34ClFO5S2 — CID 87570224
[(10S,11S,13S,17R)-17-(chloromethylsulfanylcarbonyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-phenylsulfanylbenzoate (PubChem CID 87570224) has the molecular formula C34H34ClFO5S2 and a molecular weight of 641.23 g/mol. Its IUPAC name is [(10S,11S,13S,17R)-17-(chloromethylsulfanylcarbonyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-phenylsulfanylbenzoate.
| Compound Name | [(10S,11S,13S,17R)-17-(chloromethylsulfanylcarbonyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-phenylsulfanylbenzoate |
|---|---|
| PubChem CID | 87570224 |
| Molecular Formula | C34H34ClFO5S2 |
| Molecular Weight | 641.23 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | [(10S,11S,13S,17R)-17-(chloromethylsulfanylcarbonyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-phenylsulfanylbenzoate |
| SMILES | C[C@]12C=CC(=O)C=C1CCC1C3CC[C@](OC(=O)c4ccc(Sc5ccccc5)cc4)(C(=O)SCCl)[C@@]3(C)C[C@H](O)C12F |
| InChI | InChI=1S/C34H34ClFO5S2/c1-31-16-14-23(37)18-22(31)10-13-27-26-15-17-33(30(40)42-20-35,32(26,2)19-28(38)34(27,31)36)41-29(39)21-8-11-25(12-9-21)43-24-6-4-3-5-7-24/h3-9,11-12,14,16,18,26-28,38H,10,13,15,17,19-20H2,1-2H3/t26?,27?,28-,31-,32-,33-,34?/m0/s1 |
| InChIKey | KELYQNQVDCCRRZ-VIWBCHMSSA-N |
| XLogP | 7.56 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.23 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|